About nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium
nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium (PubChem CID 58164995) has the molecular formula C8H8N3O6Y-
and a molecular weight of 331.07 g/mol. Its IUPAC name is nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium.
Molecular Properties
| Compound Name | nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium |
| PubChem CID | 58164995 |
| Molecular Formula | C8H8N3O6Y- |
| Molecular Weight | 331.07 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium |
| SMILES | O=[N+]([O-])O.[NH-]C(=O)Cc1ccc([N+](=O)[O-])cc1.[Y] |
| InChI | InChI=1S/C8H8N2O3.HNO3.Y/c9-8(11)5-6-1-3-7(4-2-6)10(12)13;2-1(3)4;/h1-4H,5H2,(H2,9,11);(H,2,3,4);/p-1 |
| InChIKey | HGGYVTULKFEPDQ-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.07 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium?
The IUPAC name of nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium (CID 58164995) is nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium.
What is the SMILES notation for nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium?
The canonical SMILES for nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium is O=[N+]([O-])O.[NH-]C(=O)Cc1ccc([N+](=O)[O-])cc1.[Y].
What is the InChIKey of nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium?
The InChIKey is HGGYVTULKFEPDQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8N2O3.HNO3.Y/c9-8(11)5-6-1-3-7(4-2-6)10(12)13;2-1(3)4;/h1-4H,5H2,(H2,9,11);(H,2,3,4);/p-1.
What are the key properties of nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium?
nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium has a molecular weight of 331.07 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for nitric acid;[2-(4-nitrophenyl)acetyl]azanide;yttrium is sourced from PubChem (CID 58164995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).