C13H18O6S — CID 58165517
(1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-methylprop-2-enoate (PubChem CID 58165517) has the molecular formula C13H18O6S and a molecular weight of 302.35 g/mol. Its IUPAC name is (1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-methylprop-2-enoate.
| Compound Name | (1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58165517 |
| Molecular Formula | C13H18O6S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C2C3OC1(C)C(C)C3(C)OS2(=O)=O |
| InChI | InChI=1S/C13H18O6S/c1-6(2)11(14)17-9-8-10-13(5,19-20(8,15)16)7(3)12(9,4)18-10/h7-10H,1H2,2-5H3 |
| InChIKey | PMMPFGIURCZFRR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|