C13H17NO — CID 58165609
4-azapentacyclo[6.4.1.13,6.02,7.09,12]tetradecan-5-one (PubChem CID 58165609) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 4-azapentacyclo[6.4.1.13,6.02,7.09,12]tetradecan-5-one.
| Compound Name | 4-azapentacyclo[6.4.1.13,6.02,7.09,12]tetradecan-5-one |
|---|---|
| PubChem CID | 58165609 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-azapentacyclo[6.4.1.13,6.02,7.09,12]tetradecan-5-one |
| SMILES | O=C1NC2CC1C1C3CC(C4CCC43)C21 |
| InChI | InChI=1S/C13H17NO/c15-13-9-4-10(14-13)12-8-3-7(11(9)12)5-1-2-6(5)8/h5-12H,1-4H2,(H,14,15) |
| InChIKey | JCKLZTGCZAQPJR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|