About 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one
4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one (PubChem CID 58165618) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one.
Molecular Properties
| Compound Name | 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one |
| PubChem CID | 58165618 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one |
| SMILES | O=C1NC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C11H15NO/c13-11-7-4-8(12-11)10-6-2-1-5(3-6)9(7)10/h5-10H,1-4H2,(H,12,13) |
| InChIKey | DUKRUYAGMUDNBT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|
Analyze 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one?
The IUPAC name of 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one (CID 58165618) is 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one.
What is the SMILES notation for 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one?
The canonical SMILES for 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one is O=C1NC2CC1C1C3CCC(C3)C21.
What is the InChIKey of 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one?
The InChIKey is DUKRUYAGMUDNBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c13-11-7-4-8(12-11)10-6-2-1-5(3-6)9(7)10/h5-10H,1-4H2,(H,12,13).
What are the key properties of 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one?
4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one has a molecular weight of 177.25 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatetracyclo[6.2.1.13,6.02,7]dodecan-5-one is sourced from PubChem (CID 58165618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).