C34H41N2O+ — CID 58165814
(E,6E)-6-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)-4-[(E)-2-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)ethenyl]hex-4-en-1-ol (PubChem CID 58165814) has the molecular formula C34H41N2O+ and a molecular weight of 493.72 g/mol. Its IUPAC name is (E,6E)-6-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)-4-[(E)-2-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)ethenyl]hex-4-en-1-ol.
| Compound Name | (E,6E)-6-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)-4-[(E)-2-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)ethenyl]hex-4-en-1-ol |
|---|---|
| PubChem CID | 58165814 |
| Molecular Formula | C34H41N2O+ |
| Molecular Weight | 493.72 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | (E,6E)-6-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)-4-[(E)-2-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraen-2-yl)ethenyl]hex-4-en-1-ol |
| SMILES | CC1(C)C(/C=C/C(=C/C=C2/N3CCCc4cccc(c43)C2(C)C)CCCO)=[N+]2CCCc3cccc1c32 |
| InChI | InChI=1S/C34H41N2O/c1-33(2)27-15-5-11-25-13-7-21-35(31(25)27)29(33)19-17-24(10-9-23-37)18-20-30-34(3,4)28-16-6-12-26-14-8-22-36(30)32(26)28/h5-6,11-12,15-20,37H,7-10,13-14,21-23H2,1-4H3/q+1 |
| InChIKey | YQVFVNLOGSBPQW-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.72 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|