About (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium
(3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium (PubChem CID 58165869) has the molecular formula C14H13N2O2Y-
and a molecular weight of 330.18 g/mol. Its IUPAC name is (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium.
Molecular Properties
| Compound Name | (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium |
| PubChem CID | 58165869 |
| Molecular Formula | C14H13N2O2Y- |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium |
| SMILES | Cc1c(N)[c-]ccc1C(=O)c1cnoc1C1CC1.[Y] |
| InChI | InChI=1S/C14H13N2O2.Y/c1-8-10(3-2-4-12(8)15)13(17)11-7-16-18-14(11)9-5-6-9;/h2-3,7,9H,5-6,15H2,1H3;/q-1; |
| InChIKey | JSESNEBHOSYJGD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium?
The IUPAC name of (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium (CID 58165869) is (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium.
What is the SMILES notation for (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium?
The canonical SMILES for (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium is Cc1c(N)[c-]ccc1C(=O)c1cnoc1C1CC1.[Y].
What is the InChIKey of (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium?
The InChIKey is JSESNEBHOSYJGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N2O2.Y/c1-8-10(3-2-4-12(8)15)13(17)11-7-16-18-14(11)9-5-6-9;/h2-3,7,9H,5-6,15H2,1H3;/q-1;.
What are the key properties of (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium?
(3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium has a molecular weight of 330.18 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-2-methylbenzene-4-id-1-yl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone;yttrium is sourced from PubChem (CID 58165869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).