About 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one
2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one (PubChem CID 58165881) has the molecular formula C23H24O2S
and a molecular weight of 364.51 g/mol. Its IUPAC name is 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one |
| PubChem CID | 58165881 |
| Molecular Formula | C23H24O2S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one |
| SMILES | Cc1cccc(C(=O)C2=C(Sc3ccccc3)CC(C)(C)CC2=O)c1C |
| InChI | InChI=1S/C23H24O2S/c1-15-9-8-12-18(16(15)2)22(25)21-19(24)13-23(3,4)14-20(21)26-17-10-6-5-7-11-17/h5-12H,13-14H2,1-4H3 |
| InChIKey | CFFIKDQPRARFEQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one?
The IUPAC name of 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one (CID 58165881) is 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one.
What is the SMILES notation for 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one?
The canonical SMILES for 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one is Cc1cccc(C(=O)C2=C(Sc3ccccc3)CC(C)(C)CC2=O)c1C.
What is the InChIKey of 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one?
The InChIKey is CFFIKDQPRARFEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O2S/c1-15-9-8-12-18(16(15)2)22(25)21-19(24)13-23(3,4)14-20(21)26-17-10-6-5-7-11-17/h5-12H,13-14H2,1-4H3.
What are the key properties of 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one?
2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one has a molecular weight of 364.51 g/mol, XLogP of 5.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylbenzoyl)-5,5-dimethyl-3-phenylsulfanylcyclohex-2-en-1-one is sourced from PubChem (CID 58165881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).