C7H10N2O2 — CID 58166119
N-methyl-N-(1,2-oxazol-3-ylmethyl)acetamide (PubChem CID 58166119) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is N-methyl-N-(1,2-oxazol-3-ylmethyl)acetamide.
| Compound Name | N-methyl-N-(1,2-oxazol-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 58166119 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | N-methyl-N-(1,2-oxazol-3-ylmethyl)acetamide |
| SMILES | CC(=O)N(C)Cc1ccon1 |
| InChI | InChI=1S/C7H10N2O2/c1-6(10)9(2)5-7-3-4-11-8-7/h3-4H,5H2,1-2H3 |
| InChIKey | VBAQHMGBLMEIKC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |