C10H17O3U- — CID 58166387
(3S,4S,5S)-5-ethyl-4-methoxy-5-prop-1-en-2-yl-3,4-dihydro-2H-furan-2-id-3-ol;uranium (PubChem CID 58166387) has the molecular formula C10H17O3U- and a molecular weight of 423.27 g/mol. Its IUPAC name is (3S,4S,5S)-5-ethyl-4-methoxy-5-prop-1-en-2-yl-3,4-dihydro-2H-furan-2-id-3-ol;uranium.
| Compound Name | (3S,4S,5S)-5-ethyl-4-methoxy-5-prop-1-en-2-yl-3,4-dihydro-2H-furan-2-id-3-ol;uranium |
|---|---|
| PubChem CID | 58166387 |
| Molecular Formula | C10H17O3U- |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (3S,4S,5S)-5-ethyl-4-methoxy-5-prop-1-en-2-yl-3,4-dihydro-2H-furan-2-id-3-ol;uranium |
| SMILES | C=C(C)[C@]1(CC)O[CH-][C@H](O)[C@@H]1OC.[U] |
| InChI | InChI=1S/C10H17O3.U/c1-5-10(7(2)3)9(12-4)8(11)6-13-10;/h6,8-9,11H,2,5H2,1,3-4H3;/q-1;/t8-,9-,10-;/m0./s1 |
| InChIKey | DSTUACYQWIWIOR-PUBMXKGKSA-N |
| XLogP | 1.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|