C19H15F2N3O — CID 58166434
5-fluoro-4-[(2-fluorophenyl)methylamino]-1-(1-phenylethenyl)pyrimidin-2-one (PubChem CID 58166434) has the molecular formula C19H15F2N3O and a molecular weight of 339.35 g/mol. Its IUPAC name is 5-fluoro-4-[(2-fluorophenyl)methylamino]-1-(1-phenylethenyl)pyrimidin-2-one.
| Compound Name | 5-fluoro-4-[(2-fluorophenyl)methylamino]-1-(1-phenylethenyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 58166434 |
| Molecular Formula | C19H15F2N3O |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 5-fluoro-4-[(2-fluorophenyl)methylamino]-1-(1-phenylethenyl)pyrimidin-2-one |
| SMILES | C=C(c1ccccc1)n1cc(F)c(NCc2ccccc2F)nc1=O |
| InChI | InChI=1S/C19H15F2N3O/c1-13(14-7-3-2-4-8-14)24-12-17(21)18(23-19(24)25)22-11-15-9-5-6-10-16(15)20/h2-10,12H,1,11H2,(H,22,23,25) |
| InChIKey | RFVGNTICARADMP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |