C25H28N3O4P — CID 58166514
3-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]propylphosphonic acid (PubChem CID 58166514) has the molecular formula C25H28N3O4P and a molecular weight of 465.49 g/mol. Its IUPAC name is 3-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]propylphosphonic acid.
| Compound Name | 3-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]propylphosphonic acid |
|---|---|
| PubChem CID | 58166514 |
| Molecular Formula | C25H28N3O4P |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 3-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-2-yl)ethyl]-3-methylphenoxy]propylphosphonic acid |
| SMILES | Cc1ccc2c(c1)nc(N)c1ncc(CCc3ccc(OCCCP(=O)(O)O)cc3C)cc12 |
| InChI | InChI=1S/C25H28N3O4P/c1-16-4-9-21-22-14-18(15-27-24(22)25(26)28-23(21)12-16)5-6-19-7-8-20(13-17(19)2)32-10-3-11-33(29,30)31/h4,7-9,12-15H,3,5-6,10-11H2,1-2H3,(H2,26,28)(H2,29,30,31) |
| InChIKey | VQMOJMMCAWMCAQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|