C22H28N6O3 — CID 58167434
8-(tert-butylamino)-6-[[6-(1-ethoxyethenyl)pyrimidin-4-yl]amino]-2-(2-hydroxyethyl)-2,7-naphthyridin-1-one (PubChem CID 58167434) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is 8-(tert-butylamino)-6-[[6-(1-ethoxyethenyl)pyrimidin-4-yl]amino]-2-(2-hydroxyethyl)-2,7-naphthyridin-1-one.
| Compound Name | 8-(tert-butylamino)-6-[[6-(1-ethoxyethenyl)pyrimidin-4-yl]amino]-2-(2-hydroxyethyl)-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 58167434 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 8-(tert-butylamino)-6-[[6-(1-ethoxyethenyl)pyrimidin-4-yl]amino]-2-(2-hydroxyethyl)-2,7-naphthyridin-1-one |
| SMILES | C=C(OCC)c1cc(Nc2cc3ccn(CCO)c(=O)c3c(NC(C)(C)C)n2)ncn1 |
| InChI | InChI=1S/C22H28N6O3/c1-6-31-14(2)16-12-17(24-13-23-16)25-18-11-15-7-8-28(9-10-29)21(30)19(15)20(26-18)27-22(3,4)5/h7-8,11-13,29H,2,6,9-10H2,1,3-5H3,(H2,23,24,25,26,27) |
| InChIKey | BFMCNZCHUGVSML-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|