C30H28FN3O5 — CID 58167773
4-[[5-[4-[3-fluoro-4-[3-(3-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]butanoic acid (PubChem CID 58167773) has the molecular formula C30H28FN3O5 and a molecular weight of 529.57 g/mol. Its IUPAC name is 4-[[5-[4-[3-fluoro-4-[3-(3-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[5-[4-[3-fluoro-4-[3-(3-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 58167773 |
| Molecular Formula | C30H28FN3O5 |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 4-[[5-[4-[3-fluoro-4-[3-(3-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]butanoic acid |
| SMILES | Cc1cccc(CC(=O)Cc2ccc(Oc3ccnc(-c4cc(C(=O)NCCCC(=O)O)c[nH]4)c3)cc2F)c1 |
| InChI | InChI=1S/C30H28FN3O5/c1-19-4-2-5-20(12-19)13-23(35)14-21-7-8-24(16-26(21)31)39-25-9-11-32-28(17-25)27-15-22(18-34-27)30(38)33-10-3-6-29(36)37/h2,4-5,7-9,11-12,15-18,34H,3,6,10,13-14H2,1H3,(H,33,38)(H,36,37) |
| InChIKey | RAXKJHHCGSXVHU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|