About 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid
4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid (PubChem CID 58167949) has the molecular formula C20H15N3O3
and a molecular weight of 345.36 g/mol. Its IUPAC name is 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid |
| PubChem CID | 58167949 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNc2ccc3c(=O)[nH]c4ncccc4c3c2)cc1 |
| InChI | InChI=1S/C20H15N3O3/c24-19-16-8-7-14(10-17(16)15-2-1-9-21-18(15)23-19)22-11-12-3-5-13(6-4-12)20(25)26/h1-10,22H,11H2,(H,25,26)(H,21,23,24) |
| InChIKey | NRPDKOVFHXAYPG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid?
The IUPAC name of 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid (CID 58167949) is 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid.
What is the SMILES notation for 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid?
The canonical SMILES for 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid is O=C(O)c1ccc(CNc2ccc3c(=O)[nH]c4ncccc4c3c2)cc1.
What is the InChIKey of 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid?
The InChIKey is NRPDKOVFHXAYPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O3/c24-19-16-8-7-14(10-17(16)15-2-1-9-21-18(15)23-19)22-11-12-3-5-13(6-4-12)20(25)26/h1-10,22H,11H2,(H,25,26)(H,21,23,24).
What are the key properties of 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid?
4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid has a molecular weight of 345.36 g/mol, XLogP of 3.39, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid is sourced from PubChem (CID 58167949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).