About 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one
2-chloro-5H-benzo[c][1,8]naphthyridin-6-one (PubChem CID 58167982) has the molecular formula C12H7ClN2O
and a molecular weight of 230.65 g/mol. Its IUPAC name is 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one.
Molecular Properties
| Compound Name | 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one |
| PubChem CID | 58167982 |
| Molecular Formula | C12H7ClN2O |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one |
| SMILES | O=c1[nH]c2ncc(Cl)cc2c2ccccc12 |
| InChI | InChI=1S/C12H7ClN2O/c13-7-5-10-8-3-1-2-4-9(8)12(16)15-11(10)14-6-7/h1-6H,(H,14,15,16) |
| InChIKey | OQZNLRBBOBBEAJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one?
The IUPAC name of 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one (CID 58167982) is 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one.
What is the SMILES notation for 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one?
The canonical SMILES for 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one is O=c1[nH]c2ncc(Cl)cc2c2ccccc12.
What is the InChIKey of 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one?
The InChIKey is OQZNLRBBOBBEAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClN2O/c13-7-5-10-8-3-1-2-4-9(8)12(16)15-11(10)14-6-7/h1-6H,(H,14,15,16).
What are the key properties of 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one?
2-chloro-5H-benzo[c][1,8]naphthyridin-6-one has a molecular weight of 230.65 g/mol, XLogP of 2.73, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5H-benzo[c][1,8]naphthyridin-6-one is sourced from PubChem (CID 58167982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).