About 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one
1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one (PubChem CID 58168082) has the molecular formula C19H14N2O3
and a molecular weight of 318.33 g/mol. Its IUPAC name is 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one.
Molecular Properties
| Compound Name | 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one |
| PubChem CID | 58168082 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one |
| SMILES | COc1ccc(Oc2ccnc3[nH]c(=O)c4ccccc4c23)cc1 |
| InChI | InChI=1S/C19H14N2O3/c1-23-12-6-8-13(9-7-12)24-16-10-11-20-18-17(16)14-4-2-3-5-15(14)19(22)21-18/h2-11H,1H3,(H,20,21,22) |
| InChIKey | ZCXUZNGHWJWEKS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one?
The IUPAC name of 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one (CID 58168082) is 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one.
What is the SMILES notation for 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one?
The canonical SMILES for 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one is COc1ccc(Oc2ccnc3[nH]c(=O)c4ccccc4c23)cc1.
What is the InChIKey of 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one?
The InChIKey is ZCXUZNGHWJWEKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O3/c1-23-12-6-8-13(9-7-12)24-16-10-11-20-18-17(16)14-4-2-3-5-15(14)19(22)21-18/h2-11H,1H3,(H,20,21,22).
What are the key properties of 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one?
1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one has a molecular weight of 318.33 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenoxy)-5H-benzo[c][1,8]naphthyridin-6-one is sourced from PubChem (CID 58168082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).