About 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one
1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one (PubChem CID 58168195) has the molecular formula C23H19N3O2
and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one.
Molecular Properties
| Compound Name | 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one |
| PubChem CID | 58168195 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one |
| SMILES | O=C(Cc1ccc(Nc2ccnc3[nH]c(=O)c4ccccc4c23)cc1)C1CC1 |
| InChI | InChI=1S/C23H19N3O2/c27-20(15-7-8-15)13-14-5-9-16(10-6-14)25-19-11-12-24-22-21(19)17-3-1-2-4-18(17)23(28)26-22/h1-6,9-12,15H,7-8,13H2,(H2,24,25,26,28) |
| InChIKey | HPYIUEXCYIESFT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one?
The IUPAC name of 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one (CID 58168195) is 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one.
What is the SMILES notation for 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one?
The canonical SMILES for 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one is O=C(Cc1ccc(Nc2ccnc3[nH]c(=O)c4ccccc4c23)cc1)C1CC1.
What is the InChIKey of 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one?
The InChIKey is HPYIUEXCYIESFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N3O2/c27-20(15-7-8-15)13-14-5-9-16(10-6-14)25-19-11-12-24-22-21(19)17-3-1-2-4-18(17)23(28)26-22/h1-6,9-12,15H,7-8,13H2,(H2,24,25,26,28).
What are the key properties of 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one?
1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one has a molecular weight of 369.42 g/mol, XLogP of 4.34, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-cyclopropyl-2-oxoethyl)anilino]-5H-benzo[c][1,8]naphthyridin-6-one is sourced from PubChem (CID 58168195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).