About N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine
N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine (PubChem CID 58168204) has the molecular formula C24H25N3O2
and a molecular weight of 387.48 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine.
Molecular Properties
| Compound Name | N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine |
| PubChem CID | 58168204 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine |
| SMILES | COc1cc2c(Nc3ccc(C(C)(C)C)cc3)nc3ncccc3c2cc1OC |
| InChI | InChI=1S/C24H25N3O2/c1-24(2,3)15-8-10-16(11-9-15)26-23-19-14-21(29-5)20(28-4)13-18(19)17-7-6-12-25-22(17)27-23/h6-14H,1-5H3,(H,25,26,27) |
| InChIKey | REEQEZCNGWUHTB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine?
The IUPAC name of N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine (CID 58168204) is N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine.
What is the SMILES notation for N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine?
The canonical SMILES for N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine is COc1cc2c(Nc3ccc(C(C)(C)C)cc3)nc3ncccc3c2cc1OC.
What is the InChIKey of N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine?
The InChIKey is REEQEZCNGWUHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N3O2/c1-24(2,3)15-8-10-16(11-9-15)26-23-19-14-21(29-5)20(28-4)13-18(19)17-7-6-12-25-22(17)27-23/h6-14H,1-5H3,(H,25,26,27).
What are the key properties of N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine?
N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine has a molecular weight of 387.48 g/mol, XLogP of 5.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butylphenyl)-8,9-dimethoxybenzo[c][1,8]naphthyridin-6-amine is sourced from PubChem (CID 58168204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).