About 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one
1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one (PubChem CID 58168379) has the molecular formula C18H12N2O2
and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one.
Molecular Properties
| Compound Name | 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one |
| PubChem CID | 58168379 |
| Molecular Formula | C18H12N2O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one |
| SMILES | O=c1[nH]c2nccc(Oc3ccccc3)c2c2ccccc12 |
| InChI | InChI=1S/C18H12N2O2/c21-18-14-9-5-4-8-13(14)16-15(10-11-19-17(16)20-18)22-12-6-2-1-3-7-12/h1-11H,(H,19,20,21) |
| InChIKey | WTABKMOPGUAUGO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one?
The IUPAC name of 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one (CID 58168379) is 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one.
What is the SMILES notation for 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one?
The canonical SMILES for 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one is O=c1[nH]c2nccc(Oc3ccccc3)c2c2ccccc12.
What is the InChIKey of 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one?
The InChIKey is WTABKMOPGUAUGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O2/c21-18-14-9-5-4-8-13(14)16-15(10-11-19-17(16)20-18)22-12-6-2-1-3-7-12/h1-11H,(H,19,20,21).
What are the key properties of 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one?
1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one has a molecular weight of 288.31 g/mol, XLogP of 3.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxy-5H-benzo[c][1,8]naphthyridin-6-one is sourced from PubChem (CID 58168379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).