C27H35ClF2N8O3 — CID 58168384
1-[4-[[4-[4-butoxy-2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-methylamino]piperidin-1-yl]-2-chloroethanone (PubChem CID 58168384) has the molecular formula C27H35ClF2N8O3 and a molecular weight of 593.08 g/mol. Its IUPAC name is 1-[4-[[4-[4-butoxy-2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-methylamino]piperidin-1-yl]-2-chloroethanone.
| Compound Name | 1-[4-[[4-[4-butoxy-2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-methylamino]piperidin-1-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 58168384 |
| Molecular Formula | C27H35ClF2N8O3 |
| Molecular Weight | 593.08 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 1-[4-[[4-[4-butoxy-2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]-methylamino]piperidin-1-yl]-2-chloroethanone |
| SMILES | CCCCOc1cccc2c1nc(C(F)F)n2-c1nc(N2CCOCC2)nc(N(C)C2CCN(C(=O)CCl)CC2)n1 |
| InChI | InChI=1S/C27H35ClF2N8O3/c1-3-4-14-41-20-7-5-6-19-22(20)31-24(23(29)30)38(19)27-33-25(32-26(34-27)37-12-15-40-16-13-37)35(2)18-8-10-36(11-9-18)21(39)17-28/h5-7,18,23H,3-4,8-17H2,1-2H3 |
| InChIKey | WMBZYCMKOIXJTA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 101.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.08 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|