About N-(2,2-diethoxyethyl)oxan-4-amine
N-(2,2-diethoxyethyl)oxan-4-amine (PubChem CID 58168483) has the molecular formula C11H23NO3
and a molecular weight of 217.31 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)oxan-4-amine.
Molecular Properties
| Compound Name | N-(2,2-diethoxyethyl)oxan-4-amine |
| PubChem CID | 58168483 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | N-(2,2-diethoxyethyl)oxan-4-amine |
| SMILES | CCOC(CNC1CCOCC1)OCC |
| InChI | InChI=1S/C11H23NO3/c1-3-14-11(15-4-2)9-12-10-5-7-13-8-6-10/h10-12H,3-9H2,1-2H3 |
| InChIKey | KCNGFGXNAPXZBD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-diethoxyethyl)oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-diethoxyethyl)oxan-4-amine?
The IUPAC name of N-(2,2-diethoxyethyl)oxan-4-amine (CID 58168483) is N-(2,2-diethoxyethyl)oxan-4-amine.
What is the SMILES notation for N-(2,2-diethoxyethyl)oxan-4-amine?
The canonical SMILES for N-(2,2-diethoxyethyl)oxan-4-amine is CCOC(CNC1CCOCC1)OCC.
What is the InChIKey of N-(2,2-diethoxyethyl)oxan-4-amine?
The InChIKey is KCNGFGXNAPXZBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3/c1-3-14-11(15-4-2)9-12-10-5-7-13-8-6-10/h10-12H,3-9H2,1-2H3.
What are the key properties of N-(2,2-diethoxyethyl)oxan-4-amine?
N-(2,2-diethoxyethyl)oxan-4-amine has a molecular weight of 217.31 g/mol, XLogP of 1.15, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-diethoxyethyl)oxan-4-amine is sourced from PubChem (CID 58168483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).