About 6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide
6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide (PubChem CID 58168659) has the molecular formula C9H11NO2S
and a molecular weight of 197.26 g/mol. Its IUPAC name is 6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide.
Analyze 6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide?
The IUPAC name of 6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide (CID 58168659) is 6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide.
What is the SMILES notation for 6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide?
The canonical SMILES for 6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide is Cc1cc2c(cn1)S(=O)(=O)CCC2.
What is the InChIKey of 6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide?
The InChIKey is FQARVWVOBWJZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c1-7-5-8-3-2-4-13(11,12)9(8)6-10-7/h5-6H,2-4H2,1H3.
What are the key properties of 6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide?
6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide has a molecular weight of 197.26 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,4-dihydro-2H-thiopyrano[2,3-c]pyridine 1,1-dioxide is sourced from PubChem (CID 58168659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).