C20H27F3N4O3S — CID 58168795
(1,1-dioxo-1,4-thiazinan-4-yl)-[4-(trifluoromethyl)-2-[[(1S,2S,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]pyrimidin-5-yl]methanone (PubChem CID 58168795) has the molecular formula C20H27F3N4O3S and a molecular weight of 460.52 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[4-(trifluoromethyl)-2-[[(1S,2S,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]pyrimidin-5-yl]methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[4-(trifluoromethyl)-2-[[(1S,2S,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 58168795 |
| Molecular Formula | C20H27F3N4O3S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[4-(trifluoromethyl)-2-[[(1S,2S,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]pyrimidin-5-yl]methanone |
| SMILES | CC1(C)[C@H]2CC[C@@](C)(C2)[C@@H]1Nc1ncc(C(=O)N2CCS(=O)(=O)CC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H27F3N4O3S/c1-18(2)12-4-5-19(3,10-12)16(18)26-17-24-11-13(14(25-17)20(21,22)23)15(28)27-6-8-31(29,30)9-7-27/h11-12,16H,4-10H2,1-3H3,(H,24,25,26)/t12-,16+,19-/m0/s1 |
| InChIKey | BZROPLJUAYSUMD-MOFZMDFASA-N |
| XLogP | 2.99 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |