C19H19F3N6O4S2 — CID 58169314
3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-2-(5-sulfamoylthiophen-2-yl)pyrimidin-5-yl]propyl 2,2,2-trifluoroacetate (PubChem CID 58169314) has the molecular formula C19H19F3N6O4S2 and a molecular weight of 516.53 g/mol. Its IUPAC name is 3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-2-(5-sulfamoylthiophen-2-yl)pyrimidin-5-yl]propyl 2,2,2-trifluoroacetate.
| Compound Name | 3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-2-(5-sulfamoylthiophen-2-yl)pyrimidin-5-yl]propyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 58169314 |
| Molecular Formula | C19H19F3N6O4S2 |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-2-(5-sulfamoylthiophen-2-yl)pyrimidin-5-yl]propyl 2,2,2-trifluoroacetate |
| SMILES | NS(=O)(=O)c1ccc(-c2ncc(CCCOC(=O)C(F)(F)F)c(Nc3cc(C4CC4)[nH]n3)n2)s1 |
| InChI | InChI=1S/C19H19F3N6O4S2/c20-19(21,22)18(29)32-7-1-2-11-9-24-17(13-5-6-15(33-13)34(23,30)31)26-16(11)25-14-8-12(27-28-14)10-3-4-10/h5-6,8-10H,1-4,7H2,(H2,23,30,31)(H2,24,25,26,27,28) |
| InChIKey | SUPQWIHFWRUVJT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|