C20H21N5O2S — CID 58169423
1-[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]butane-1,4-diol (PubChem CID 58169423) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 1-[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]butane-1,4-diol.
| Compound Name | 1-[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]butane-1,4-diol |
|---|---|
| PubChem CID | 58169423 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]butane-1,4-diol |
| SMILES | C#Cc1cnc(-c2ccc(C(O)CCCO)s2)nc1Nc1cc(C2CC2)[nH]n1 |
| InChI | InChI=1S/C20H21N5O2S/c1-2-12-11-21-20(17-8-7-16(28-17)15(27)4-3-9-26)23-19(12)22-18-10-14(24-25-18)13-5-6-13/h1,7-8,10-11,13,15,26-27H,3-6,9H2,(H2,21,22,23,24,25) |
| InChIKey | DNGWWSJWFPKNGS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|