C21H24ClN5O2 — CID 58169808
6-chloro-1-[6-(2-methoxyethylamino)-2-(2-methylpropyl)pyrazolo[3,4-d]pyrimidin-4-yl]-1,3-dihydroinden-2-one (PubChem CID 58169808) has the molecular formula C21H24ClN5O2 and a molecular weight of 413.91 g/mol. Its IUPAC name is 6-chloro-1-[6-(2-methoxyethylamino)-2-(2-methylpropyl)pyrazolo[3,4-d]pyrimidin-4-yl]-1,3-dihydroinden-2-one.
| Compound Name | 6-chloro-1-[6-(2-methoxyethylamino)-2-(2-methylpropyl)pyrazolo[3,4-d]pyrimidin-4-yl]-1,3-dihydroinden-2-one |
|---|---|
| PubChem CID | 58169808 |
| Molecular Formula | C21H24ClN5O2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 6-chloro-1-[6-(2-methoxyethylamino)-2-(2-methylpropyl)pyrazolo[3,4-d]pyrimidin-4-yl]-1,3-dihydroinden-2-one |
| SMILES | COCCNc1nc(C2C(=O)Cc3ccc(Cl)cc32)c2cn(CC(C)C)nc2n1 |
| InChI | InChI=1S/C21H24ClN5O2/c1-12(2)10-27-11-16-19(24-21(23-6-7-29-3)25-20(16)26-27)18-15-9-14(22)5-4-13(15)8-17(18)28/h4-5,9,11-12,18H,6-8,10H2,1-3H3,(H,23,25,26) |
| InChIKey | JEBCWVNCUPGPCU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|