C28H31F7N4O2 — CID 58169859
(2S,5S,7R)-8-N-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluoro-2-methylphenyl)-8-N-methyl-1,8-diazaspiro[4.5]decane-2,8-dicarboxamide (PubChem CID 58169859) has the molecular formula C28H31F7N4O2 and a molecular weight of 588.57 g/mol. Its IUPAC name is (2S,5S,7R)-8-N-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluoro-2-methylphenyl)-8-N-methyl-1,8-diazaspiro[4.5]decane-2,8-dicarboxamide.
| Compound Name | (2S,5S,7R)-8-N-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluoro-2-methylphenyl)-8-N-methyl-1,8-diazaspiro[4.5]decane-2,8-dicarboxamide |
|---|---|
| PubChem CID | 58169859 |
| Molecular Formula | C28H31F7N4O2 |
| Molecular Weight | 588.57 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | (2S,5S,7R)-8-N-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluoro-2-methylphenyl)-8-N-methyl-1,8-diazaspiro[4.5]decane-2,8-dicarboxamide |
| SMILES | Cc1cc(F)ccc1[C@H]1C[C@]2(CC[C@@H](C(N)=O)N2)CCN1C(=O)N(C)[C@@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H31F7N4O2/c1-15-10-20(29)4-5-21(15)23-14-26(7-6-22(37-26)24(36)40)8-9-39(23)25(41)38(3)16(2)17-11-18(27(30,31)32)13-19(12-17)28(33,34)35/h4-5,10-13,16,22-23,37H,6-9,14H2,1-3H3,(H2,36,40)/t16-,22-,23+,26-/m0/s1 |
| InChIKey | VCBSUJRRMDZCKA-WBXIOGJFSA-N |
| XLogP | 6.10 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |