C27H29F7N4O2 — CID 58169865
(2R,5S,7R)-8-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7-(4-fluoro-2-methylphenyl)-8-N-methyl-1,8-diazaspiro[4.5]decane-2,8-dicarboxamide (PubChem CID 58169865) has the molecular formula C27H29F7N4O2 and a molecular weight of 574.54 g/mol. Its IUPAC name is (2R,5S,7R)-8-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7-(4-fluoro-2-methylphenyl)-8-N-methyl-1,8-diazaspiro[4.5]decane-2,8-dicarboxamide.
| Compound Name | (2R,5S,7R)-8-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7-(4-fluoro-2-methylphenyl)-8-N-methyl-1,8-diazaspiro[4.5]decane-2,8-dicarboxamide |
|---|---|
| PubChem CID | 58169865 |
| Molecular Formula | C27H29F7N4O2 |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | (2R,5S,7R)-8-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-7-(4-fluoro-2-methylphenyl)-8-N-methyl-1,8-diazaspiro[4.5]decane-2,8-dicarboxamide |
| SMILES | Cc1cc(F)ccc1[C@H]1C[C@]2(CC[C@H](C(N)=O)N2)CCN1C(=O)N(C)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H29F7N4O2/c1-15-9-19(28)3-4-20(15)22-13-25(6-5-21(36-25)23(35)39)7-8-38(22)24(40)37(2)14-16-10-17(26(29,30)31)12-18(11-16)27(32,33)34/h3-4,9-12,21-22,36H,5-8,13-14H2,1-2H3,(H2,35,39)/t21-,22-,25+/m1/s1 |
| InChIKey | WHWVTYYKIBPKMU-RQTOMXEWSA-N |
| XLogP | 5.54 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |