About 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline
4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline (PubChem CID 58170298) has the molecular formula C23H19FN2O2
and a molecular weight of 374.42 g/mol. Its IUPAC name is 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline.
Molecular Properties
| Compound Name | 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline |
| PubChem CID | 58170298 |
| Molecular Formula | C23H19FN2O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline |
| SMILES | COc1ccc(-c2ccc(Oc3ccnc4cc(C)c(C)cc34)c(F)c2)cn1 |
| InChI | InChI=1S/C23H19FN2O2/c1-14-10-18-20(11-15(14)2)25-9-8-21(18)28-22-6-4-16(12-19(22)24)17-5-7-23(27-3)26-13-17/h4-13H,1-3H3 |
| InChIKey | CWLCYHBTIFEIFK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline?
The IUPAC name of 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline (CID 58170298) is 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline.
What is the SMILES notation for 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline?
The canonical SMILES for 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline is COc1ccc(-c2ccc(Oc3ccnc4cc(C)c(C)cc34)c(F)c2)cn1.
What is the InChIKey of 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline?
The InChIKey is CWLCYHBTIFEIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19FN2O2/c1-14-10-18-20(11-15(14)2)25-9-8-21(18)28-22-6-4-16(12-19(22)24)17-5-7-23(27-3)26-13-17/h4-13H,1-3H3.
What are the key properties of 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline?
4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline has a molecular weight of 374.42 g/mol, XLogP of 5.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-fluoro-4-(6-methoxy-3-pyridinyl)phenoxy]-6,7-dimethylquinoline is sourced from PubChem (CID 58170298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).