C16H15NS3 — CID 58171079
5-(1-benzothiophen-3-yl)-1-(1,3-thiazol-2-yl)pentane-2-thione (PubChem CID 58171079) has the molecular formula C16H15NS3 and a molecular weight of 317.50 g/mol. Its IUPAC name is 5-(1-benzothiophen-3-yl)-1-(1,3-thiazol-2-yl)pentane-2-thione.
| Compound Name | 5-(1-benzothiophen-3-yl)-1-(1,3-thiazol-2-yl)pentane-2-thione |
|---|---|
| PubChem CID | 58171079 |
| Molecular Formula | C16H15NS3 |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 5-(1-benzothiophen-3-yl)-1-(1,3-thiazol-2-yl)pentane-2-thione |
| SMILES | S=C(CCCc1csc2ccccc12)Cc1nccs1 |
| InChI | InChI=1S/C16H15NS3/c18-13(10-16-17-8-9-19-16)5-3-4-12-11-20-15-7-2-1-6-14(12)15/h1-2,6-9,11H,3-5,10H2 |
| InChIKey | KYYVIGCYNXYEOC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|