C11H13NS — CID 58171102
1,3,4,4a,5,9b-hexahydrothiopyrano[4,3-b]indole (PubChem CID 58171102) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is 1,3,4,4a,5,9b-hexahydrothiopyrano[4,3-b]indole.
| Compound Name | 1,3,4,4a,5,9b-hexahydrothiopyrano[4,3-b]indole |
|---|---|
| PubChem CID | 58171102 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 1,3,4,4a,5,9b-hexahydrothiopyrano[4,3-b]indole |
| SMILES | c1ccc2c(c1)NC1CCSCC21 |
| InChI | InChI=1S/C11H13NS/c1-2-4-10-8(3-1)9-7-13-6-5-11(9)12-10/h1-4,9,11-12H,5-7H2 |
| InChIKey | VCEJLDZOGNTIPH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |