C24H20BrN3O3 — CID 58171187
1-[2-bromo-5-(pyridin-2-ylmethoxy)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 58171187) has the molecular formula C24H20BrN3O3 and a molecular weight of 478.35 g/mol. Its IUPAC name is 1-[2-bromo-5-(pyridin-2-ylmethoxy)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 1-[2-bromo-5-(pyridin-2-ylmethoxy)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 58171187 |
| Molecular Formula | C24H20BrN3O3 |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 1-[2-bromo-5-(pyridin-2-ylmethoxy)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2c([nH]c3ccccc23)C(c2cc(OCc3ccccn3)ccc2Br)N1 |
| InChI | InChI=1S/C24H20BrN3O3/c25-19-9-8-15(31-13-14-5-3-4-10-26-14)11-18(19)23-22-17(12-21(28-23)24(29)30)16-6-1-2-7-20(16)27-22/h1-11,21,23,27-28H,12-13H2,(H,29,30) |
| InChIKey | LYTCCMQIGJXOIN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|