About spiro[1H-indole-3,3'-oxolane]-2-one
spiro[1H-indole-3,3'-oxolane]-2-one (PubChem CID 58171286) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is spiro[1H-indole-3,3'-oxolane]-2-one.
Molecular Properties
| Compound Name | spiro[1H-indole-3,3'-oxolane]-2-one |
| PubChem CID | 58171286 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | spiro[1H-indole-3,3'-oxolane]-2-one |
| SMILES | O=C1Nc2ccccc2C12CCOC2 |
| InChI | InChI=1S/C11H11NO2/c13-10-11(5-6-14-7-11)8-3-1-2-4-9(8)12-10/h1-4H,5-7H2,(H,12,13) |
| InChIKey | NNIUNZKAUJWBRU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1H-indole-3,3'-oxolane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-indole-3,3'-oxolane]-2-one?
The IUPAC name of spiro[1H-indole-3,3'-oxolane]-2-one (CID 58171286) is spiro[1H-indole-3,3'-oxolane]-2-one.
What is the SMILES notation for spiro[1H-indole-3,3'-oxolane]-2-one?
The canonical SMILES for spiro[1H-indole-3,3'-oxolane]-2-one is O=C1Nc2ccccc2C12CCOC2.
What is the InChIKey of spiro[1H-indole-3,3'-oxolane]-2-one?
The InChIKey is NNIUNZKAUJWBRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c13-10-11(5-6-14-7-11)8-3-1-2-4-9(8)12-10/h1-4H,5-7H2,(H,12,13).
What are the key properties of spiro[1H-indole-3,3'-oxolane]-2-one?
spiro[1H-indole-3,3'-oxolane]-2-one has a molecular weight of 189.21 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-indole-3,3'-oxolane]-2-one is sourced from PubChem (CID 58171286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).