About 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid
1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid (PubChem CID 58171329) has the molecular formula C13H15NO2S
and a molecular weight of 249.34 g/mol. Its IUPAC name is 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid.
Molecular Properties
| Compound Name | 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid |
| PubChem CID | 58171329 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid |
| SMILES | CN1CC2(CSC(C(=O)O)C2)c2ccccc21 |
| InChI | InChI=1S/C13H15NO2S/c1-14-7-13(6-11(12(15)16)17-8-13)9-4-2-3-5-10(9)14/h2-5,11H,6-8H2,1H3,(H,15,16) |
| InChIKey | NEDCLBSNWKVNIS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid?
The IUPAC name of 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid (CID 58171329) is 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid.
What is the SMILES notation for 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid?
The canonical SMILES for 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid is CN1CC2(CSC(C(=O)O)C2)c2ccccc21.
What is the InChIKey of 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid?
The InChIKey is NEDCLBSNWKVNIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2S/c1-14-7-13(6-11(12(15)16)17-8-13)9-4-2-3-5-10(9)14/h2-5,11H,6-8H2,1H3,(H,15,16).
What are the key properties of 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid?
1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid has a molecular weight of 249.34 g/mol, XLogP of 1.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylspiro[2H-indole-3,4'-thiolane]-2'-carboxylic acid is sourced from PubChem (CID 58171329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).