C13H16N2O3 — CID 58171340
(2S)-3-[(3aS,8bS)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-yl]-2-aminopropanoic acid (PubChem CID 58171340) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is (2S)-3-[(3aS,8bS)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-yl]-2-aminopropanoic acid.
| Compound Name | (2S)-3-[(3aS,8bS)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-yl]-2-aminopropanoic acid |
|---|---|
| PubChem CID | 58171340 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2S)-3-[(3aS,8bS)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-yl]-2-aminopropanoic acid |
| SMILES | N[C@@H](C[C@@]12CCO[C@@H]1Nc1ccccc12)C(=O)O |
| InChI | InChI=1S/C13H16N2O3/c14-9(11(16)17)7-13-5-6-18-12(13)15-10-4-2-1-3-8(10)13/h1-4,9,12,15H,5-7,14H2,(H,16,17)/t9-,12-,13+/m0/s1 |
| InChIKey | QBLWBZOCHDOHCD-TVYUQYBPSA-N |
| XLogP | 0.90 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |