About N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide
N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide (PubChem CID 58171417) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide.
Molecular Properties
| Compound Name | N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide |
| PubChem CID | 58171417 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide |
| SMILES | CC(=O)N(O)C(C)n1c2ccccc2c2ccncc21 |
| InChI | InChI=1S/C15H15N3O2/c1-10(18(20)11(2)19)17-14-6-4-3-5-12(14)13-7-8-16-9-15(13)17/h3-10,20H,1-2H3 |
| InChIKey | QIRRKSQCJFICSM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide?
The IUPAC name of N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide (CID 58171417) is N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide.
What is the SMILES notation for N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide?
The canonical SMILES for N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide is CC(=O)N(O)C(C)n1c2ccccc2c2ccncc21.
What is the InChIKey of N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide?
The InChIKey is QIRRKSQCJFICSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c1-10(18(20)11(2)19)17-14-6-4-3-5-12(14)13-7-8-16-9-15(13)17/h3-10,20H,1-2H3.
What are the key properties of N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide?
N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide has a molecular weight of 269.30 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N-(1-pyrido[3,4-b]indol-9-ylethyl)acetamide is sourced from PubChem (CID 58171417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).