About 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile
6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile (PubChem CID 58171840) has the molecular formula C18H17F2N3O
and a molecular weight of 329.35 g/mol. Its IUPAC name is 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile |
| PubChem CID | 58171840 |
| Molecular Formula | C18H17F2N3O |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile |
| SMILES | C[C@H](Oc1ccc(C#N)cn1)[C@H]1CNCC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H17F2N3O/c1-11(24-18-5-2-12(7-21)8-23-18)14-9-22-10-15(14)13-3-4-16(19)17(20)6-13/h2-6,8,11,14-15,22H,9-10H2,1H3/t11-,14+,15?/m0/s1 |
| InChIKey | ZQTDQJZXAMCHKT-NFCBODTESA-N |
| XLogP | 3.00 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile?
The IUPAC name of 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile (CID 58171840) is 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile?
The canonical SMILES for 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile is C[C@H](Oc1ccc(C#N)cn1)[C@H]1CNCC1c1ccc(F)c(F)c1.
What is the InChIKey of 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile?
The InChIKey is ZQTDQJZXAMCHKT-NFCBODTESA-N. The full InChI is InChI=1S/C18H17F2N3O/c1-11(24-18-5-2-12(7-21)8-23-18)14-9-22-10-15(14)13-3-4-16(19)17(20)6-13/h2-6,8,11,14-15,22H,9-10H2,1H3/t11-,14+,15?/m0/s1.
What are the key properties of 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile?
6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile has a molecular weight of 329.35 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1S)-1-[(3R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]ethoxy]pyridine-3-carbonitrile is sourced from PubChem (CID 58171840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).