About (2-oxocyclopentyl) piperidine-1-carbodithioate
(2-oxocyclopentyl) piperidine-1-carbodithioate (PubChem CID 581721) has the molecular formula C11H17NOS2
and a molecular weight of 243.40 g/mol. Its IUPAC name is (2-oxocyclopentyl) piperidine-1-carbodithioate.
Molecular Properties
| Compound Name | (2-oxocyclopentyl) piperidine-1-carbodithioate |
| PubChem CID | 581721 |
| Molecular Formula | C11H17NOS2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | (2-oxocyclopentyl) piperidine-1-carbodithioate |
| SMILES | O=C1CCCC1SC(=S)N1CCCCC1 |
| InChI | InChI=1S/C11H17NOS2/c13-9-5-4-6-10(9)15-11(14)12-7-2-1-3-8-12/h10H,1-8H2 |
| InChIKey | WECNIUXOOQPAMG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-oxocyclopentyl) piperidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxocyclopentyl) piperidine-1-carbodithioate?
The IUPAC name of (2-oxocyclopentyl) piperidine-1-carbodithioate (CID 581721) is (2-oxocyclopentyl) piperidine-1-carbodithioate.
What is the SMILES notation for (2-oxocyclopentyl) piperidine-1-carbodithioate?
The canonical SMILES for (2-oxocyclopentyl) piperidine-1-carbodithioate is O=C1CCCC1SC(=S)N1CCCCC1.
What is the InChIKey of (2-oxocyclopentyl) piperidine-1-carbodithioate?
The InChIKey is WECNIUXOOQPAMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NOS2/c13-9-5-4-6-10(9)15-11(14)12-7-2-1-3-8-12/h10H,1-8H2.
What are the key properties of (2-oxocyclopentyl) piperidine-1-carbodithioate?
(2-oxocyclopentyl) piperidine-1-carbodithioate has a molecular weight of 243.40 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxocyclopentyl) piperidine-1-carbodithioate is sourced from PubChem (CID 581721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).