About 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine
3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine (PubChem CID 58172176) has the molecular formula C19H30ClN3
and a molecular weight of 335.92 g/mol. Its IUPAC name is 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine |
| PubChem CID | 58172176 |
| Molecular Formula | C19H30ClN3 |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine |
| SMILES | CC(C)(C)N1CC2(CCN(CCCN)CC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H30ClN3/c1-18(2,3)23-14-19(16-13-15(20)5-6-17(16)23)7-11-22(12-8-19)10-4-9-21/h5-6,13H,4,7-12,14,21H2,1-3H3 |
| InChIKey | SVWVJRBGOCQGOU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine?
The IUPAC name of 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine (CID 58172176) is 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine.
What is the SMILES notation for 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine?
The canonical SMILES for 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine is CC(C)(C)N1CC2(CCN(CCCN)CC2)c2cc(Cl)ccc21.
What is the InChIKey of 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine?
The InChIKey is SVWVJRBGOCQGOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30ClN3/c1-18(2,3)23-14-19(16-13-15(20)5-6-17(16)23)7-11-22(12-8-19)10-4-9-21/h5-6,13H,4,7-12,14,21H2,1-3H3.
What are the key properties of 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine?
3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine has a molecular weight of 335.92 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-tert-butyl-5-chlorospiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-amine is sourced from PubChem (CID 58172176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).