C27H39NO — CID 58172261
1,3,3-tritert-butyl-6-phenylmethoxy-2H-indole (PubChem CID 58172261) has the molecular formula C27H39NO and a molecular weight of 393.62 g/mol. Its IUPAC name is 1,3,3-tritert-butyl-6-phenylmethoxy-2H-indole.
| Compound Name | 1,3,3-tritert-butyl-6-phenylmethoxy-2H-indole |
|---|---|
| PubChem CID | 58172261 |
| Molecular Formula | C27H39NO |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.30 |
| IUPAC Name | 1,3,3-tritert-butyl-6-phenylmethoxy-2H-indole |
| SMILES | CC(C)(C)N1CC(C(C)(C)C)(C(C)(C)C)c2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C27H39NO/c1-24(2,3)27(25(4,5)6)19-28(26(7,8)9)23-17-21(15-16-22(23)27)29-18-20-13-11-10-12-14-20/h10-17H,18-19H2,1-9H3 |
| InChIKey | YGXDDXPOSVYJCL-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |