C18H19N3O5S2 — CID 58172474
(2R)-2-[[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]methyl]pyrrolidine-1-sulfonic acid (PubChem CID 58172474) has the molecular formula C18H19N3O5S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is (2R)-2-[[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]methyl]pyrrolidine-1-sulfonic acid.
| Compound Name | (2R)-2-[[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]methyl]pyrrolidine-1-sulfonic acid |
|---|---|
| PubChem CID | 58172474 |
| Molecular Formula | C18H19N3O5S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | (2R)-2-[[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]methyl]pyrrolidine-1-sulfonic acid |
| SMILES | O=S(=O)(O)N1CCC[C@@H]1Cc1cc2cccnc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19N3O5S2/c22-27(23,17-8-2-1-3-9-17)21-16(12-14-6-4-10-19-18(14)21)13-15-7-5-11-20(15)28(24,25)26/h1-4,6,8-10,12,15H,5,7,11,13H2,(H,24,25,26)/t15-/m1/s1 |
| InChIKey | VSNOOJSXEPHADT-OAHLLOKOSA-N |
| XLogP | 2.08 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|