C22H22ClFN4O5 — CID 58172528
5-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-N-hydroxy-4-oxopentanamide (PubChem CID 58172528) has the molecular formula C22H22ClFN4O5 and a molecular weight of 476.89 g/mol. Its IUPAC name is 5-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-N-hydroxy-4-oxopentanamide.
| Compound Name | 5-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-N-hydroxy-4-oxopentanamide |
|---|---|
| PubChem CID | 58172528 |
| Molecular Formula | C22H22ClFN4O5 |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 5-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-N-hydroxy-4-oxopentanamide |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1CC(=O)CCC(=O)NO |
| InChI | InChI=1S/C22H22ClFN4O5/c1-32-6-7-33-20-11-19-16(9-13(20)8-15(29)3-5-21(30)28-31)22(26-12-25-19)27-14-2-4-18(24)17(23)10-14/h2,4,9-12,31H,3,5-8H2,1H3,(H,28,30)(H,25,26,27) |
| InChIKey | ZCSBILFYFHQCNT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|