C34H34ClFN4O5 — CID 58172549
8-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxyoctanamide (PubChem CID 58172549) has the molecular formula C34H34ClFN4O5 and a molecular weight of 633.12 g/mol. Its IUPAC name is 8-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxyoctanamide.
| Compound Name | 8-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxyoctanamide |
|---|---|
| PubChem CID | 58172549 |
| Molecular Formula | C34H34ClFN4O5 |
| Molecular Weight | 633.12 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | 8-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxyoctanamide |
| SMILES | COc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1-c1ccc(CCCCCCCC(=O)NO)o1 |
| InChI | InChI=1S/C34H34ClFN4O5/c1-43-32-19-29-26(18-27(32)30-15-13-25(45-30)10-5-3-2-4-6-11-33(41)40-42)34(38-21-37-29)39-24-12-14-31(28(35)17-24)44-20-22-8-7-9-23(36)16-22/h7-9,12-19,21,42H,2-6,10-11,20H2,1H3,(H,40,41)(H,37,38,39) |
| InChIKey | UCKJRMSSNBMXBQ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.12 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|