C36H37ClFN3O5 — CID 58172576
10-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-1-hydroxydecan-2-one (PubChem CID 58172576) has the molecular formula C36H37ClFN3O5 and a molecular weight of 646.16 g/mol. Its IUPAC name is 10-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-1-hydroxydecan-2-one.
| Compound Name | 10-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-1-hydroxydecan-2-one |
|---|---|
| PubChem CID | 58172576 |
| Molecular Formula | C36H37ClFN3O5 |
| Molecular Weight | 646.16 g/mol |
| Exact Mass | 645.24 |
| IUPAC Name | 10-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-1-hydroxydecan-2-one |
| SMILES | COc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1-c1ccc(CCCCCCCCC(=O)CO)o1 |
| InChI | InChI=1S/C36H37ClFN3O5/c1-44-35-20-32-29(19-30(35)33-16-14-28(46-33)12-7-5-3-2-4-6-11-27(43)21-42)36(40-23-39-32)41-26-13-15-34(31(37)18-26)45-22-24-9-8-10-25(38)17-24/h8-10,13-20,23,42H,2-7,11-12,21-22H2,1H3,(H,39,40,41) |
| InChIKey | WTLGXYPZLHLIED-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.16 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|