C34H33ClFN3O5 — CID 58172600
8-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-1-hydroxyoctan-2-one (PubChem CID 58172600) has the molecular formula C34H33ClFN3O5 and a molecular weight of 618.11 g/mol. Its IUPAC name is 8-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-1-hydroxyoctan-2-one.
| Compound Name | 8-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-1-hydroxyoctan-2-one |
|---|---|
| PubChem CID | 58172600 |
| Molecular Formula | C34H33ClFN3O5 |
| Molecular Weight | 618.11 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | 8-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-1-hydroxyoctan-2-one |
| SMILES | COc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1-c1ccc(CCCCCCC(=O)CO)o1 |
| InChI | InChI=1S/C34H33ClFN3O5/c1-42-33-18-30-27(17-28(33)31-14-12-26(44-31)10-5-3-2-4-9-25(41)19-40)34(38-21-37-30)39-24-11-13-32(29(35)16-24)43-20-22-7-6-8-23(36)15-22/h6-8,11-18,21,40H,2-5,9-10,19-20H2,1H3,(H,37,38,39) |
| InChIKey | CESRPNRPDNARER-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.11 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|