C32H30ClFN4O5 — CID 58172603
6-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxyhexanamide (PubChem CID 58172603) has the molecular formula C32H30ClFN4O5 and a molecular weight of 605.07 g/mol. Its IUPAC name is 6-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxyhexanamide.
| Compound Name | 6-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 58172603 |
| Molecular Formula | C32H30ClFN4O5 |
| Molecular Weight | 605.07 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | 6-[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxyhexanamide |
| SMILES | COc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1-c1ccc(CCCCCC(=O)NO)o1 |
| InChI | InChI=1S/C32H30ClFN4O5/c1-41-30-17-27-24(16-25(30)28-13-11-23(43-28)8-3-2-4-9-31(39)38-40)32(36-19-35-27)37-22-10-12-29(26(33)15-22)42-18-20-6-5-7-21(34)14-20/h5-7,10-17,19,40H,2-4,8-9,18H2,1H3,(H,38,39)(H,35,36,37) |
| InChIKey | FIPFWIWQYBFMOF-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.07 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|