C29H26N6O — CID 58172734
3-[(4,5-dideuterio-6-pyridin-3-ylpyrimidin-2-yl)amino]-N-[2,4,6-trideuterio-3-(2,5-dideuterio-3-methylpyrrol-1-yl)-5-methylphenyl]-4-(trideuteriomethyl)benzamide (PubChem CID 58172734) has the molecular formula C29H26N6O and a molecular weight of 484.63 g/mol. Its IUPAC name is 3-[(4,5-dideuterio-6-pyridin-3-ylpyrimidin-2-yl)amino]-N-[2,4,6-trideuterio-3-(2,5-dideuterio-3-methylpyrrol-1-yl)-5-methylphenyl]-4-(trideuteriomethyl)benzamide.
| Compound Name | 3-[(4,5-dideuterio-6-pyridin-3-ylpyrimidin-2-yl)amino]-N-[2,4,6-trideuterio-3-(2,5-dideuterio-3-methylpyrrol-1-yl)-5-methylphenyl]-4-(trideuteriomethyl)benzamide |
|---|---|
| PubChem CID | 58172734 |
| Molecular Formula | C29H26N6O |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 3-[(4,5-dideuterio-6-pyridin-3-ylpyrimidin-2-yl)amino]-N-[2,4,6-trideuterio-3-(2,5-dideuterio-3-methylpyrrol-1-yl)-5-methylphenyl]-4-(trideuteriomethyl)benzamide |
| SMILES | [2H]c1nc(Nc2cc(C(=O)Nc3c([2H])c(C)c([2H])c(-n4c([2H])cc(C)c4[2H])c3[2H])ccc2C([2H])([2H])[2H])nc(-c2cccnc2)c1[2H] |
| InChI | InChI=1S/C29H26N6O/c1-19-9-12-35(18-19)25-14-20(2)13-24(16-25)32-28(36)22-7-6-21(3)27(15-22)34-29-31-11-8-26(33-29)23-5-4-10-30-17-23/h4-18H,1-3H3,(H,32,36)(H,31,33,34)/i3D3,8D,11D,12D,13D,14D,16D,18D |
| InChIKey | XILUVNTTYYPCCU-VWVNIQDNSA-N |
| XLogP | 6.25 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |