C26H28N6 — CID 58173089
3-[4-(diethylaminomethyl)triazol-1-yl]-N-[4-[(E)-2-pyridin-4-ylethenyl]phenyl]aniline (PubChem CID 58173089) has the molecular formula C26H28N6 and a molecular weight of 424.55 g/mol. Its IUPAC name is 3-[4-(diethylaminomethyl)triazol-1-yl]-N-[4-[(E)-2-pyridin-4-ylethenyl]phenyl]aniline.
| Compound Name | 3-[4-(diethylaminomethyl)triazol-1-yl]-N-[4-[(E)-2-pyridin-4-ylethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 58173089 |
| Molecular Formula | C26H28N6 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 3-[4-(diethylaminomethyl)triazol-1-yl]-N-[4-[(E)-2-pyridin-4-ylethenyl]phenyl]aniline |
| SMILES | CCN(CC)Cc1cn(-c2cccc(Nc3ccc(/C=C/c4ccncc4)cc3)c2)nn1 |
| InChI | InChI=1S/C26H28N6/c1-3-31(4-2)19-25-20-32(30-29-25)26-7-5-6-24(18-26)28-23-12-10-21(11-13-23)8-9-22-14-16-27-17-15-22/h5-18,20,28H,3-4,19H2,1-2H3/b9-8+ |
| InChIKey | UDFMDPLVYXUPHM-CMDGGOBGSA-N |
| XLogP | 5.42 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |