C31H47NO5 — CID 58173199
methyl (2S,3R)-3-[(2S)-2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]propanoyl]oxy-2-methylbutanoate (PubChem CID 58173199) has the molecular formula C31H47NO5 and a molecular weight of 513.72 g/mol. Its IUPAC name is methyl (2S,3R)-3-[(2S)-2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]propanoyl]oxy-2-methylbutanoate.
| Compound Name | methyl (2S,3R)-3-[(2S)-2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]propanoyl]oxy-2-methylbutanoate |
|---|---|
| PubChem CID | 58173199 |
| Molecular Formula | C31H47NO5 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.35 |
| IUPAC Name | methyl (2S,3R)-3-[(2S)-2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]propanoyl]oxy-2-methylbutanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N[C@@H](C)C(=O)O[C@H](C)[C@H](C)C(=O)OC |
| InChI | InChI=1S/C31H47NO5/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-29(33)32-27(3)31(35)37-28(4)26(2)30(34)36-5/h7-8,10-11,13-14,16-17,19-20,22-23,26-28H,6,9,12,15,18,21,24-25H2,1-5H3,(H,32,33)/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22-/t26-,27-,28+/m0/s1 |
| InChIKey | OWPQLXHMXPXRPE-UGIWDUSHSA-N |
| XLogP | 6.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|