C42H49N4O4+ — CID 58173204
5-[5-(tert-butylamino)pentylcarbamoyl]-2-(3-oxa-9-aza-27-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1,4(15),5(28),13,16,18,21,23(27)-octaen-16-yl)benzoic acid (PubChem CID 58173204) has the molecular formula C42H49N4O4+ and a molecular weight of 673.88 g/mol. Its IUPAC name is 5-[5-(tert-butylamino)pentylcarbamoyl]-2-(3-oxa-9-aza-27-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1,4(15),5(28),13,16,18,21,23(27)-octaen-16-yl)benzoic acid.
| Compound Name | 5-[5-(tert-butylamino)pentylcarbamoyl]-2-(3-oxa-9-aza-27-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1,4(15),5(28),13,16,18,21,23(27)-octaen-16-yl)benzoic acid |
|---|---|
| PubChem CID | 58173204 |
| Molecular Formula | C42H49N4O4+ |
| Molecular Weight | 673.88 g/mol |
| Exact Mass | 673.37 |
| IUPAC Name | 5-[5-(tert-butylamino)pentylcarbamoyl]-2-(3-oxa-9-aza-27-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1,4(15),5(28),13,16,18,21,23(27)-octaen-16-yl)benzoic acid |
| SMILES | CC(C)(C)NCCCCCNC(=O)c1ccc(C2=c3cc4[n+]5c(c3Oc3c2cc2c6c3CCCN6CCC2)CCCC=5C=CC4)c(C(=O)O)c1 |
| InChI | InChI=1S/C42H48N4O4/c1-42(2,3)44-20-6-4-5-19-43-40(47)27-17-18-30(32(24-27)41(48)49)36-33-23-26-11-9-21-45-22-10-15-31(37(26)45)38(33)50-39-34(36)25-29-14-7-12-28-13-8-16-35(39)46(28)29/h7,12,17-18,23-25,44H,4-6,8-11,13-16,19-22H2,1-3H3,(H-,43,47,48,49)/p+1 |
| InChIKey | DPGFOHNATHFARE-UHFFFAOYSA-O |
| XLogP | 5.84 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.88 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|